C20H24N2OS — CID 971289
(3R,5S)-N-(1,3-benzothiazol-2-yl)-3,5-dimethyladamantane-1-carboxamide (PubChem CID 971289) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is (3R,5S)-N-(1,3-benzothiazol-2-yl)-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | (3R,5S)-N-(1,3-benzothiazol-2-yl)-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 971289 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (3R,5S)-N-(1,3-benzothiazol-2-yl)-3,5-dimethyladamantane-1-carboxamide |
| SMILES | C[C@]12CC3CC(C(=O)Nc4nc5ccccc5s4)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C20H24N2OS/c1-18-7-13-8-19(2,10-18)12-20(9-13,11-18)16(23)22-17-21-14-5-3-4-6-15(14)24-17/h3-6,13H,7-12H2,1-2H3,(H,21,22,23)/t13?,18-,19+,20? |
| InChIKey | AWXOMXZGBCOYRJ-GOSFSIBNSA-N |
| XLogP | 5.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |