C16H23N5OS — CID 38231768
1-(1,3-benzothiazol-2-yl)-3-[2-(4-ethylpiperazin-1-yl)ethyl]urea (PubChem CID 38231768) has the molecular formula C16H23N5OS and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[2-(4-ethylpiperazin-1-yl)ethyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[2-(4-ethylpiperazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 38231768 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[2-(4-ethylpiperazin-1-yl)ethyl]urea |
| SMILES | CCN1CCN(CCNC(=O)Nc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C16H23N5OS/c1-2-20-9-11-21(12-10-20)8-7-17-15(22)19-16-18-13-5-3-4-6-14(13)23-16/h3-6H,2,7-12H2,1H3,(H2,17,18,19,22) |
| InChIKey | ZXUYYLUKYUPHQQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |