C17H24N4OS — CID 91511220
1-(1,3-benzothiazol-2-yl)-3-[2-(2,6-dimethylpiperidin-1-yl)ethyl]urea (PubChem CID 91511220) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-3-[2-(2,6-dimethylpiperidin-1-yl)ethyl]urea.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-3-[2-(2,6-dimethylpiperidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 91511220 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-3-[2-(2,6-dimethylpiperidin-1-yl)ethyl]urea |
| SMILES | CC1CCCC(C)N1CCNC(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H24N4OS/c1-12-6-5-7-13(2)21(12)11-10-18-16(22)20-17-19-14-8-3-4-9-15(14)23-17/h3-4,8-9,12-13H,5-7,10-11H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | YNEFENZPADDXFN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |