C20H21N5O2S — CID 78777861
[4-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1-carbonyl]phenyl]urea (PubChem CID 78777861) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is [4-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1-carbonyl]phenyl]urea.
| Compound Name | [4-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1-carbonyl]phenyl]urea |
|---|---|
| PubChem CID | 78777861 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [4-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1-carbonyl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(C(=O)N2CCN(Cc3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C20H21N5O2S/c21-20(27)22-15-7-5-14(6-8-15)19(26)25-11-9-24(10-12-25)13-18-23-16-3-1-2-4-17(16)28-18/h1-8H,9-13H2,(H3,21,22,27) |
| InChIKey | RBXLWEWXMKWUBP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |