C18H16Cl2N4OS — CID 8797033
[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-(5,6-dichloro-3-pyridinyl)methanone (PubChem CID 8797033) has the molecular formula C18H16Cl2N4OS and a molecular weight of 407.33 g/mol. Its IUPAC name is [4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-(5,6-dichloro-3-pyridinyl)methanone.
| Compound Name | [4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-(5,6-dichloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 8797033 |
| Molecular Formula | C18H16Cl2N4OS |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | [4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]-(5,6-dichloro-3-pyridinyl)methanone |
| SMILES | O=C(c1cnc(Cl)c(Cl)c1)N1CCN(Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C18H16Cl2N4OS/c19-13-9-12(10-21-17(13)20)18(25)24-7-5-23(6-8-24)11-16-22-14-3-1-2-4-15(14)26-16/h1-4,9-10H,5-8,11H2 |
| InChIKey | FHLJGRKBNJNRQY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|