C17H22N4OS — CID 100836004
1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3-benzothiazol-2-ylmethyl)urea (PubChem CID 100836004) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3-benzothiazol-2-ylmethyl)urea.
| Compound Name | 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3-benzothiazol-2-ylmethyl)urea |
|---|---|
| PubChem CID | 100836004 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3-benzothiazol-2-ylmethyl)urea |
| SMILES | O=C(NCc1nc2ccccc2s1)N[C@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C17H22N4OS/c22-17(20-12-8-10-21-9-4-3-6-14(12)21)18-11-16-19-13-5-1-2-7-15(13)23-16/h1-2,5,7,12,14H,3-4,6,8-11H2,(H2,18,20,22)/t12-,14-/m0/s1 |
| InChIKey | VQURZFQCCCDXRQ-JSGCOSHPSA-N |
| XLogP | 2.72 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |