C19H25N3OS — CID 100839288
N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-4-(1,3-benzothiazol-2-yl)butanamide (PubChem CID 100839288) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-4-(1,3-benzothiazol-2-yl)butanamide.
| Compound Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-4-(1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 100839288 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-4-(1,3-benzothiazol-2-yl)butanamide |
| SMILES | O=C(CCCc1nc2ccccc2s1)N[C@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C19H25N3OS/c23-18(20-14-11-13-22-12-4-3-7-16(14)22)9-5-10-19-21-15-6-1-2-8-17(15)24-19/h1-2,6,8,14,16H,3-5,7,9-13H2,(H,20,23)/t14-,16-/m0/s1 |
| InChIKey | SXBOBFYHVWMRNP-HOCLYGCPSA-N |
| XLogP | 3.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |