C17H25Cl2N3OS — CID 119478669
N-(4-aminocyclohexyl)-4-(1,3-benzothiazol-2-yl)butanamide;dihydrochloride (PubChem CID 119478669) has the molecular formula C17H25Cl2N3OS and a molecular weight of 390.38 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-(1,3-benzothiazol-2-yl)butanamide;dihydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-4-(1,3-benzothiazol-2-yl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119478669 |
| Molecular Formula | C17H25Cl2N3OS |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-(1,3-benzothiazol-2-yl)butanamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(NC(=O)CCCc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C17H23N3OS.2ClH/c18-12-8-10-13(11-9-12)19-16(21)6-3-7-17-20-14-4-1-2-5-15(14)22-17;;/h1-2,4-5,12-13H,3,6-11,18H2,(H,19,21);2*1H |
| InChIKey | BRHIEJUUQUYULQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |