C15H18N2OS — CID 9215184
3-(1,3-benzothiazol-2-yl)-N-cyclopentylpropanamide (PubChem CID 9215184) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-cyclopentylpropanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 9215184 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-cyclopentylpropanamide |
| SMILES | O=C(CCc1nc2ccccc2s1)NC1CCCC1 |
| InChI | InChI=1S/C15H18N2OS/c18-14(16-11-5-1-2-6-11)9-10-15-17-12-7-3-4-8-13(12)19-15/h3-4,7-8,11H,1-2,5-6,9-10H2,(H,16,18) |
| InChIKey | NUQWBYCQUYDCCE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |