C14H22N4OS — CID 100836225
1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(2-methyl-1,3-thiazol-4-yl)methyl]urea (PubChem CID 100836225) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(2-methyl-1,3-thiazol-4-yl)methyl]urea.
| Compound Name | 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(2-methyl-1,3-thiazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 100836225 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(2-methyl-1,3-thiazol-4-yl)methyl]urea |
| SMILES | Cc1nc(CNC(=O)N[C@H]2CCN3CCCC[C@@H]23)cs1 |
| InChI | InChI=1S/C14H22N4OS/c1-10-16-11(9-20-10)8-15-14(19)17-12-5-7-18-6-3-2-4-13(12)18/h9,12-13H,2-8H2,1H3,(H2,15,17,19)/t12-,13-/m0/s1 |
| InChIKey | YIZGYBUANGKIJL-STQMWFEESA-N |
| XLogP | 1.88 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |