C17H26N4O2 — CID 94030850
1-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(2-ethoxy-3-pyridinyl)methyl]urea (PubChem CID 94030850) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(2-ethoxy-3-pyridinyl)methyl]urea.
| Compound Name | 1-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(2-ethoxy-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 94030850 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[(1S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[(2-ethoxy-3-pyridinyl)methyl]urea |
| SMILES | CCOc1ncccc1CNC(=O)N[C@H]1CCN2CCCC[C@H]12 |
| InChI | InChI=1S/C17H26N4O2/c1-2-23-16-13(6-5-9-18-16)12-19-17(22)20-14-8-11-21-10-4-3-7-15(14)21/h5-6,9,14-15H,2-4,7-8,10-12H2,1H3,(H2,19,20,22)/t14-,15+/m0/s1 |
| InChIKey | PWSUSBJBSHJKAR-LSDHHAIUSA-N |
| XLogP | 1.91 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |