C14H21N3OS — CID 100836010
1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 100836010) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 100836010 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCc1cccs1)N[C@@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C14H21N3OS/c18-14(15-10-11-4-3-9-19-11)16-12-6-8-17-7-2-1-5-13(12)17/h3-4,9,12-13H,1-2,5-8,10H2,(H2,15,16,18)/t12-,13+/m1/s1 |
| InChIKey | FJJOOMUENLGHRD-OLZOCXBDSA-N |
| XLogP | 2.17 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |