C12H19N3O3S2 — CID 36509584
1-(1-methylsulfonylpiperidin-4-yl)-3-(thiophen-2-ylmethyl)urea (PubChem CID 36509584) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 1-(1-methylsulfonylpiperidin-4-yl)-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 36509584 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-(thiophen-2-ylmethyl)urea |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)NCc2cccs2)CC1 |
| InChI | InChI=1S/C12H19N3O3S2/c1-20(17,18)15-6-4-10(5-7-15)14-12(16)13-9-11-3-2-8-19-11/h2-3,8,10H,4-7,9H2,1H3,(H2,13,14,16) |
| InChIKey | ATDDOTHVYOKTNF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |