C18H20FN3O2S — CID 86998872
1-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 86998872) has the molecular formula C18H20FN3O2S and a molecular weight of 361.44 g/mol. Its IUPAC name is 1-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 86998872 |
| Molecular Formula | C18H20FN3O2S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 1-[1-(2-fluorobenzoyl)piperidin-4-yl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | O=C(NCc1cccs1)NC1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H20FN3O2S/c19-16-6-2-1-5-15(16)17(23)22-9-7-13(8-10-22)21-18(24)20-12-14-4-3-11-25-14/h1-6,11,13H,7-10,12H2,(H2,20,21,24) |
| InChIKey | HXRQZLIGQMNYIL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |