C22H29N3O3S — CID 31989348
1-(3,3-diphenylpropyl)-3-(1-methylsulfonylpiperidin-4-yl)urea (PubChem CID 31989348) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-(1-methylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-(3,3-diphenylpropyl)-3-(1-methylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 31989348 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-(1-methylsulfonylpiperidin-4-yl)urea |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)NCCC(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O3S/c1-29(27,28)25-16-13-20(14-17-25)24-22(26)23-15-12-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20-21H,12-17H2,1H3,(H2,23,24,26) |
| InChIKey | YFYKOTARIQQTFE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |