C13H20N4O3S — CID 110706203
1-(1-methylsulfonylpiperidin-4-yl)-3-(pyridin-4-ylmethyl)urea (PubChem CID 110706203) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is 1-(1-methylsulfonylpiperidin-4-yl)-3-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 110706203 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(1-methylsulfonylpiperidin-4-yl)-3-(pyridin-4-ylmethyl)urea |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)NCc2ccncc2)CC1 |
| InChI | InChI=1S/C13H20N4O3S/c1-21(19,20)17-8-4-12(5-9-17)16-13(18)15-10-11-2-6-14-7-3-11/h2-3,6-7,12H,4-5,8-10H2,1H3,(H2,15,16,18) |
| InChIKey | YZOSHEBAARZTEO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |