C13H21N5O3S — CID 53498208
1-[6-(methylamino)-3-pyridinyl]-3-(1-methylsulfonylpiperidin-4-yl)urea (PubChem CID 53498208) has the molecular formula C13H21N5O3S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-[6-(methylamino)-3-pyridinyl]-3-(1-methylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-[6-(methylamino)-3-pyridinyl]-3-(1-methylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 53498208 |
| Molecular Formula | C13H21N5O3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[6-(methylamino)-3-pyridinyl]-3-(1-methylsulfonylpiperidin-4-yl)urea |
| SMILES | CNc1ccc(NC(=O)NC2CCN(S(C)(=O)=O)CC2)cn1 |
| InChI | InChI=1S/C13H21N5O3S/c1-14-12-4-3-11(9-15-12)17-13(19)16-10-5-7-18(8-6-10)22(2,20)21/h3-4,9-10H,5-8H2,1-2H3,(H,14,15)(H2,16,17,19) |
| InChIKey | DDXKCHPRTXNJNY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |