C13H18FN3O6S2 — CID 118566531
4-[(4-fluorosulfonyloxyphenyl)carbamoylamino]-1-methylsulfonylpiperidine (PubChem CID 118566531) has the molecular formula C13H18FN3O6S2 and a molecular weight of 395.43 g/mol. Its IUPAC name is 4-[(4-fluorosulfonyloxyphenyl)carbamoylamino]-1-methylsulfonylpiperidine.
| Compound Name | 4-[(4-fluorosulfonyloxyphenyl)carbamoylamino]-1-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 118566531 |
| Molecular Formula | C13H18FN3O6S2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 4-[(4-fluorosulfonyloxyphenyl)carbamoylamino]-1-methylsulfonylpiperidine |
| SMILES | CS(=O)(=O)N1CCC(NC(=O)Nc2ccc(OS(=O)(=O)F)cc2)CC1 |
| InChI | InChI=1S/C13H18FN3O6S2/c1-24(19,20)17-8-6-11(7-9-17)16-13(18)15-10-2-4-12(5-3-10)23-25(14,21)22/h2-5,11H,6-9H2,1H3,(H2,15,16,18) |
| InChIKey | PHXLSKLYVNGEFH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |