C16H20N4O5S — CID 24664745
1-(2-methyl-1,3-dioxoisoindol-5-yl)-3-(1-methylsulfonylpiperidin-4-yl)urea (PubChem CID 24664745) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dioxoisoindol-5-yl)-3-(1-methylsulfonylpiperidin-4-yl)urea.
| Compound Name | 1-(2-methyl-1,3-dioxoisoindol-5-yl)-3-(1-methylsulfonylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 24664745 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-(2-methyl-1,3-dioxoisoindol-5-yl)-3-(1-methylsulfonylpiperidin-4-yl)urea |
| SMILES | CN1C(=O)c2ccc(NC(=O)NC3CCN(S(C)(=O)=O)CC3)cc2C1=O |
| InChI | InChI=1S/C16H20N4O5S/c1-19-14(21)12-4-3-11(9-13(12)15(19)22)18-16(23)17-10-5-7-20(8-6-10)26(2,24)25/h3-4,9-10H,5-8H2,1-2H3,(H2,17,18,23) |
| InChIKey | LUYQPNCWODFODD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|