C14H19N5OS — CID 95771302
1-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 95771302) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is 1-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 95771302 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-[(3R)-1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | Cn1cc(N2CC[C@@H](NC(=O)NCc3cccs3)C2)cn1 |
| InChI | InChI=1S/C14H19N5OS/c1-18-10-12(7-16-18)19-5-4-11(9-19)17-14(20)15-8-13-3-2-6-21-13/h2-3,6-7,10-11H,4-5,8-9H2,1H3,(H2,15,17,20)/t11-/m1/s1 |
| InChIKey | OLAUXCSEUJIFLW-LLVKDONJSA-N |
| XLogP | 1.56 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |