C14H17N5OS — CID 166232118
(E)-N-[1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-3-(1,3-thiazol-5-yl)prop-2-enamide (PubChem CID 166232118) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is (E)-N-[1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-3-(1,3-thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-3-(1,3-thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 166232118 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (E)-N-[1-(1-methylpyrazol-4-yl)pyrrolidin-3-yl]-3-(1,3-thiazol-5-yl)prop-2-enamide |
| SMILES | Cn1cc(N2CCC(NC(=O)/C=C/c3cncs3)C2)cn1 |
| InChI | InChI=1S/C14H17N5OS/c1-18-9-12(6-16-18)19-5-4-11(8-19)17-14(20)3-2-13-7-15-10-21-13/h2-3,6-7,9-11H,4-5,8H2,1H3,(H,17,20)/b3-2+ |
| InChIKey | PPSUJZAXHNLPLN-NSCUHMNNSA-N |
| XLogP | 1.28 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|