C20H25N3O2S — CID 23733080
N-[2-(benzylcarbamoylamino)cyclohexyl]-2-thiophen-2-ylacetamide (PubChem CID 23733080) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is N-[2-(benzylcarbamoylamino)cyclohexyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(benzylcarbamoylamino)cyclohexyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 23733080 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[2-(benzylcarbamoylamino)cyclohexyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)NC1CCCCC1NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H25N3O2S/c24-19(13-16-9-6-12-26-16)22-17-10-4-5-11-18(17)23-20(25)21-14-15-7-2-1-3-8-15/h1-3,6-9,12,17-18H,4-5,10-11,13-14H2,(H,22,24)(H2,21,23,25) |
| InChIKey | RWRWTCRMQXSEEA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |