C14H21NOS — CID 27235346
N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-2-thiophen-2-ylacetamide (PubChem CID 27235346) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 27235346 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-2-thiophen-2-ylacetamide |
| SMILES | C[C@H]1[C@@H](NC(=O)Cc2cccs2)CCC[C@@H]1C |
| InChI | InChI=1S/C14H21NOS/c1-10-5-3-7-13(11(10)2)15-14(16)9-12-6-4-8-17-12/h4,6,8,10-11,13H,3,5,7,9H2,1-2H3,(H,15,16)/t10-,11+,13-/m0/s1 |
| InChIKey | SOVMQLPTWXWCEA-LOWVWBTDSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |