C22H26N2OS — CID 98429828
N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-thiophen-2-ylindol-1-yl)acetamide (PubChem CID 98429828) has the molecular formula C22H26N2OS and a molecular weight of 366.53 g/mol. Its IUPAC name is N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-thiophen-2-ylindol-1-yl)acetamide.
| Compound Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-thiophen-2-ylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 98429828 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-(2-thiophen-2-ylindol-1-yl)acetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)Cn1c(-c2cccs2)cc2ccccc21 |
| InChI | InChI=1S/C22H26N2OS/c1-15-7-5-9-18(16(15)2)23-22(25)14-24-19-10-4-3-8-17(19)13-20(24)21-11-6-12-26-21/h3-4,6,8,10-13,15-16,18H,5,7,9,14H2,1-2H3,(H,23,25)/t15-,16+,18+/m1/s1 |
| InChIKey | KMOJDCWSFRGPSV-RYRKJORJSA-N |
| XLogP | 5.31 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |