C23H26N2O2 — CID 98750987
N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 98750987) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 98750987 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C23H26N2O2/c1-15-8-7-11-19(16(15)2)24-22(26)14-25-20-12-5-3-9-17(20)23(27)18-10-4-6-13-21(18)25/h3-6,9-10,12-13,15-16,19H,7-8,11,14H2,1-2H3,(H,24,26)/t15-,16+,19+/m1/s1 |
| InChIKey | QQFXMJRGSYGKQY-GJYPPUQNSA-N |
| XLogP | 4.10 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|