C21H28N2O3 — CID 129419658
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-(1-ethyl-2-oxoquinolin-4-yl)oxyacetamide (PubChem CID 129419658) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-(1-ethyl-2-oxoquinolin-4-yl)oxyacetamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-(1-ethyl-2-oxoquinolin-4-yl)oxyacetamide |
|---|---|
| PubChem CID | 129419658 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-2-(1-ethyl-2-oxoquinolin-4-yl)oxyacetamide |
| SMILES | CCn1c(=O)cc(OCC(=O)N[C@@H]2CCC[C@@H](C)[C@H]2C)c2ccccc21 |
| InChI | InChI=1S/C21H28N2O3/c1-4-23-18-11-6-5-9-16(18)19(12-21(23)25)26-13-20(24)22-17-10-7-8-14(2)15(17)3/h5-6,9,11-12,14-15,17H,4,7-8,10,13H2,1-3H3,(H,22,24)/t14-,15-,17-/m1/s1 |
| InChIKey | JAOXKAFDLUVVBS-BFYDXBDKSA-N |
| XLogP | 3.34 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |