C17H22N2O2 — CID 6601783
2-(2-cyanophenoxy)-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 6601783) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 6601783 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@H]1[C@@H](NC(=O)COc2ccccc2C#N)CCC[C@@H]1C |
| InChI | InChI=1S/C17H22N2O2/c1-12-6-5-8-15(13(12)2)19-17(20)11-21-16-9-4-3-7-14(16)10-18/h3-4,7,9,12-13,15H,5-6,8,11H2,1-2H3,(H,19,20)/t12-,13+,15-/m0/s1 |
| InChIKey | QNMCZQYMRXCADO-GUTXKFCHSA-N |
| XLogP | 2.88 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |