C20H25NO2 — CID 11917810
N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-naphthalen-1-yloxyacetamide (PubChem CID 11917810) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-naphthalen-1-yloxyacetamide.
| Compound Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-naphthalen-1-yloxyacetamide |
|---|---|
| PubChem CID | 11917810 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-naphthalen-1-yloxyacetamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=O)COc1cccc2ccccc12 |
| InChI | InChI=1S/C20H25NO2/c1-14-7-5-11-18(15(14)2)21-20(22)13-23-19-12-6-9-16-8-3-4-10-17(16)19/h3-4,6,8-10,12,14-15,18H,5,7,11,13H2,1-2H3,(H,21,22)/t14-,15-,18+/m1/s1 |
| InChIKey | JFIVXUZBAWNTKD-RKVPGOIHSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |