C16H21Cl2NO2 — CID 11915896
2-(2,3-dichlorophenoxy)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11915896) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.26 g/mol. Its IUPAC name is 2-(2,3-dichlorophenoxy)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-(2,3-dichlorophenoxy)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11915896 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(2,3-dichlorophenoxy)-N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=O)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H21Cl2NO2/c1-10-5-3-7-13(11(10)2)19-15(20)9-21-14-8-4-6-12(17)16(14)18/h4,6,8,10-11,13H,3,5,7,9H2,1-2H3,(H,19,20)/t10-,11+,13+/m0/s1 |
| InChIKey | KDGTWCDIALIWMC-DMDPSCGWSA-N |
| XLogP | 4.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |