C17H24ClN3O2S — CID 11946461
1-[[2-(2-chlorophenoxy)acetyl]amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11946461) has the molecular formula C17H24ClN3O2S and a molecular weight of 369.92 g/mol. Its IUPAC name is 1-[[2-(2-chlorophenoxy)acetyl]amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[[2-(2-chlorophenoxy)acetyl]amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11946461 |
| Molecular Formula | C17H24ClN3O2S |
| Molecular Weight | 369.92 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-[[2-(2-chlorophenoxy)acetyl]amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1[C@@H](C)CCC[C@H]1NC(=S)NNC(=O)COc1ccccc1Cl |
| InChI | InChI=1S/C17H24ClN3O2S/c1-11-6-5-8-14(12(11)2)19-17(24)21-20-16(22)10-23-15-9-4-3-7-13(15)18/h3-4,7,9,11-12,14H,5-6,8,10H2,1-2H3,(H,20,22)(H2,19,21,24)/t11-,12+,14+/m0/s1 |
| InChIKey | BBTVDOBDCCLVKB-OUCADQQQSA-N |
| XLogP | 3.04 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|