C20H30N4O3S — CID 11946026
N-[2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-2-oxoethyl]-2-ethoxybenzamide (PubChem CID 11946026) has the molecular formula C20H30N4O3S and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-2-oxoethyl]-2-ethoxybenzamide.
| Compound Name | N-[2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-2-oxoethyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 11946026 |
| Molecular Formula | C20H30N4O3S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[2-[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]carbamothioyl]hydrazinyl]-2-oxoethyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)NNC(=S)N[C@H]1CCC[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C20H30N4O3S/c1-4-27-17-11-6-5-9-15(17)19(26)21-12-18(25)23-24-20(28)22-16-10-7-8-13(2)14(16)3/h5-6,9,11,13-14,16H,4,7-8,10,12H2,1-3H3,(H,21,26)(H,23,25)(H2,22,24,28)/t13-,14+,16+/m1/s1 |
| InChIKey | CETDRFITPIALFC-YCPHGPKFSA-N |
| XLogP | 2.14 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|