C16H24N4O3S — CID 9425595
N-[2-[2-(tert-butylcarbamothioyl)hydrazinyl]-2-oxoethyl]-2-ethoxybenzamide (PubChem CID 9425595) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[2-[2-(tert-butylcarbamothioyl)hydrazinyl]-2-oxoethyl]-2-ethoxybenzamide.
| Compound Name | N-[2-[2-(tert-butylcarbamothioyl)hydrazinyl]-2-oxoethyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 9425595 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-[2-[2-(tert-butylcarbamothioyl)hydrazinyl]-2-oxoethyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)NNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C16H24N4O3S/c1-5-23-12-9-7-6-8-11(12)14(22)17-10-13(21)19-20-15(24)18-16(2,3)4/h6-9H,5,10H2,1-4H3,(H,17,22)(H,19,21)(H2,18,20,24) |
| InChIKey | NONUWVYSUCVOFG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|