C19H26N2O — CID 7328535
N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-(2-methylindol-1-yl)acetamide (PubChem CID 7328535) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-(2-methylindol-1-yl)acetamide.
| Compound Name | N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-(2-methylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 7328535 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N-[(1R,2R,3S)-2,3-dimethylcyclohexyl]-2-(2-methylindol-1-yl)acetamide |
| SMILES | Cc1cc2ccccc2n1CC(=O)N[C@@H]1CCC[C@H](C)[C@H]1C |
| InChI | InChI=1S/C19H26N2O/c1-13-7-6-9-17(15(13)3)20-19(22)12-21-14(2)11-16-8-4-5-10-18(16)21/h4-5,8,10-11,13,15,17H,6-7,9,12H2,1-3H3,(H,20,22)/t13-,15+,17+/m0/s1 |
| InChIKey | ZCAFLKUJZUZMIA-YSVLISHTSA-N |
| XLogP | 3.89 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |