C18H24N2O — CID 40655877
N-[(1S,2R)-2-methylcyclohexyl]-2-(2-methylindol-1-yl)acetamide (PubChem CID 40655877) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcyclohexyl]-2-(2-methylindol-1-yl)acetamide.
| Compound Name | N-[(1S,2R)-2-methylcyclohexyl]-2-(2-methylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 40655877 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-[(1S,2R)-2-methylcyclohexyl]-2-(2-methylindol-1-yl)acetamide |
| SMILES | Cc1cc2ccccc2n1CC(=O)N[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C18H24N2O/c1-13-7-3-5-9-16(13)19-18(21)12-20-14(2)11-15-8-4-6-10-17(15)20/h4,6,8,10-11,13,16H,3,5,7,9,12H2,1-2H3,(H,19,21)/t13-,16+/m1/s1 |
| InChIKey | OCEPDGUSODCJRQ-CJNGLKHVSA-N |
| XLogP | 3.64 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |