C15H20N4O — CID 8025550
2-(benzotriazol-1-yl)-N-[(1S,2R)-2-methylcyclohexyl]acetamide (PubChem CID 8025550) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[(1S,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 8025550 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C15H20N4O/c1-11-6-2-3-7-12(11)16-15(20)10-19-14-9-5-4-8-13(14)17-18-19/h4-5,8-9,11-12H,2-3,6-7,10H2,1H3,(H,16,20)/t11-,12+/m1/s1 |
| InChIKey | OVASKPBYMJUDQX-NEPJUHHUSA-N |
| XLogP | 2.13 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |