C18H23N3O2 — CID 857351
N-[(1R,2R)-2-methylcyclohexyl]-2-(4-methyl-1-oxophthalazin-2-yl)acetamide (PubChem CID 857351) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-2-(4-methyl-1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-2-(4-methyl-1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 857351 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-2-(4-methyl-1-oxophthalazin-2-yl)acetamide |
| SMILES | Cc1nn(CC(=O)N[C@@H]2CCCC[C@H]2C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C18H23N3O2/c1-12-7-3-6-10-16(12)19-17(22)11-21-18(23)15-9-5-4-8-14(15)13(2)20-21/h4-5,8-9,12,16H,3,6-7,10-11H2,1-2H3,(H,19,22)/t12-,16-/m1/s1 |
| InChIKey | KGUOQJQTOBBRIM-MLGOLLRUSA-N |
| XLogP | 2.40 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |