C18H22N2O2 — CID 9354452
N-[(1S,2R)-2-methylcyclohexyl]-2-(1-oxoisoquinolin-2-yl)acetamide (PubChem CID 9354452) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcyclohexyl]-2-(1-oxoisoquinolin-2-yl)acetamide.
| Compound Name | N-[(1S,2R)-2-methylcyclohexyl]-2-(1-oxoisoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 9354452 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-[(1S,2R)-2-methylcyclohexyl]-2-(1-oxoisoquinolin-2-yl)acetamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)Cn1ccc2ccccc2c1=O |
| InChI | InChI=1S/C18H22N2O2/c1-13-6-2-5-9-16(13)19-17(21)12-20-11-10-14-7-3-4-8-15(14)18(20)22/h3-4,7-8,10-11,13,16H,2,5-6,9,12H2,1H3,(H,19,21)/t13-,16+/m1/s1 |
| InChIKey | MQNKBLVJVBAJNV-CJNGLKHVSA-N |
| XLogP | 2.70 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |