C15H18N4O3 — CID 23908032
[2-(cyclopentylamino)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate (PubChem CID 23908032) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate |
|---|---|
| PubChem CID | 23908032 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate |
| SMILES | O=C(COC(=O)Cn1nnc2ccccc21)NC1CCCC1 |
| InChI | InChI=1S/C15H18N4O3/c20-14(16-11-5-1-2-6-11)10-22-15(21)9-19-13-8-4-3-7-12(13)17-18-19/h3-4,7-8,11H,1-2,5-6,9-10H2,(H,16,20) |
| InChIKey | YELAWIHUEGTVDH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |