C16H15N5O5S — CID 25037674
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(benzotriazol-1-yl)acetate (PubChem CID 25037674) has the molecular formula C16H15N5O5S and a molecular weight of 389.39 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(benzotriazol-1-yl)acetate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(benzotriazol-1-yl)acetate |
|---|---|
| PubChem CID | 25037674 |
| Molecular Formula | C16H15N5O5S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(benzotriazol-1-yl)acetate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)Cn2nnc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15N5O5S/c17-27(24,25)12-7-5-11(6-8-12)18-15(22)10-26-16(23)9-21-14-4-2-1-3-13(14)19-20-21/h1-8H,9-10H2,(H,18,22)(H2,17,24,25) |
| InChIKey | RNDOWBZGKLAOMS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |