C17H16N4O3 — CID 2554046
[2-(benzylamino)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate (PubChem CID 2554046) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate |
|---|---|
| PubChem CID | 2554046 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] 2-(benzotriazol-1-yl)acetate |
| SMILES | O=C(COC(=O)Cn1nnc2ccccc21)NCc1ccccc1 |
| InChI | InChI=1S/C17H16N4O3/c22-16(18-10-13-6-2-1-3-7-13)12-24-17(23)11-21-15-9-5-4-8-14(15)19-20-21/h1-9H,10-12H2,(H,18,22) |
| InChIKey | YACGZUPDWMDKGV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |