C17H16N4O4 — CID 71900117
5-[[[2-(benzotriazol-1-yl)acetyl]amino]methyl]-2-methoxybenzoic acid (PubChem CID 71900117) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 5-[[[2-(benzotriazol-1-yl)acetyl]amino]methyl]-2-methoxybenzoic acid.
| Compound Name | 5-[[[2-(benzotriazol-1-yl)acetyl]amino]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 71900117 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-[[[2-(benzotriazol-1-yl)acetyl]amino]methyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(CNC(=O)Cn2nnc3ccccc32)cc1C(=O)O |
| InChI | InChI=1S/C17H16N4O4/c1-25-15-7-6-11(8-12(15)17(23)24)9-18-16(22)10-21-14-5-3-2-4-13(14)19-20-21/h2-8H,9-10H2,1H3,(H,18,22)(H,23,24) |
| InChIKey | OSPBMJRZABKINC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |