C22H21N5O3 — CID 47042658
2-(benzotriazol-1-yl)-N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]acetamide (PubChem CID 47042658) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(benzotriazol-1-yl)-N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 47042658 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-(benzotriazol-1-yl)-N-[[3-methoxy-4-(pyridin-4-ylmethoxy)phenyl]methyl]acetamide |
| SMILES | COc1cc(CNC(=O)Cn2nnc3ccccc32)ccc1OCc1ccncc1 |
| InChI | InChI=1S/C22H21N5O3/c1-29-21-12-17(6-7-20(21)30-15-16-8-10-23-11-9-16)13-24-22(28)14-27-19-5-3-2-4-18(19)25-26-27/h2-12H,13-15H2,1H3,(H,24,28) |
| InChIKey | ZNHLNXJTLXSWRC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |