C14H15N3O7S — CID 4029983
[2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(2,5-dioxopyrrolidin-1-yl)acetate (PubChem CID 4029983) has the molecular formula C14H15N3O7S and a molecular weight of 369.36 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(2,5-dioxopyrrolidin-1-yl)acetate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
|---|---|
| PubChem CID | 4029983 |
| Molecular Formula | C14H15N3O7S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] 2-(2,5-dioxopyrrolidin-1-yl)acetate |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)COC(=O)CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C14H15N3O7S/c15-25(22,23)10-3-1-9(2-4-10)16-11(18)8-24-14(21)7-17-12(19)5-6-13(17)20/h1-4H,5-8H2,(H,16,18)(H2,15,22,23) |
| InChIKey | DXRMABNEBCIDKD-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|