C19H23N3O7S — CID 55941638
[2-oxo-2-(4-sulfamoylanilino)ethyl] (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 55941638) has the molecular formula C19H23N3O7S and a molecular weight of 437.47 g/mol. Its IUPAC name is [2-oxo-2-(4-sulfamoylanilino)ethyl] (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55941638 |
| Molecular Formula | C19H23N3O7S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [2-oxo-2-(4-sulfamoylanilino)ethyl] (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)Nc1ccc(S(N)(=O)=O)cc1)N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C19H23N3O7S/c1-11(22-17(24)14-4-2-3-5-15(14)18(22)25)19(26)29-10-16(23)21-12-6-8-13(9-7-12)30(20,27)28/h6-9,11,14-15H,2-5,10H2,1H3,(H,21,23)(H2,20,27,28)/t11-,14?,15?/m0/s1 |
| InChIKey | DEVOIAIYHOOJFZ-QGLTVNCISA-N |
| XLogP | 0.38 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|