C24H31N3O6 — CID 55927609
[2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 55927609) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55927609 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | [2-[4-(diethylcarbamoyl)anilino]-2-oxoethyl] (2S)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)COC(=O)[C@H](C)N2C(=O)C3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C24H31N3O6/c1-4-26(5-2)21(29)16-10-12-17(13-11-16)25-20(28)14-33-24(32)15(3)27-22(30)18-8-6-7-9-19(18)23(27)31/h10-13,15,18-19H,4-9,14H2,1-3H3,(H,25,28)/t15-,18?,19?/m0/s1 |
| InChIKey | LBZWOFMWMSOAFC-MNNVXMFVSA-N |
| XLogP | 2.21 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|