C23H31N3O7S — CID 55324279
[2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate (PubChem CID 55324279) has the molecular formula C23H31N3O7S and a molecular weight of 493.58 g/mol. Its IUPAC name is [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate.
| Compound Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55324279 |
| Molecular Formula | C23H31N3O7S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | [2-[4-(diethylsulfamoyl)anilino]-2-oxoethyl] 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)COC(=O)C(C)N2C(=O)C3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C23H31N3O7S/c1-4-25(5-2)34(31,32)17-12-10-16(11-13-17)24-20(27)14-33-23(30)15(3)26-21(28)18-8-6-7-9-19(18)22(26)29/h10-13,15,18-19H,4-9,14H2,1-3H3,(H,24,27) |
| InChIKey | DPLSBBIMWZTFPD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|