C22H31N3O5S — CID 41293196
(2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[3-(diethylsulfamoyl)-4-methylphenyl]propanamide (PubChem CID 41293196) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[3-(diethylsulfamoyl)-4-methylphenyl]propanamide.
| Compound Name | (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[3-(diethylsulfamoyl)-4-methylphenyl]propanamide |
|---|---|
| PubChem CID | 41293196 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (2S)-2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[3-(diethylsulfamoyl)-4-methylphenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)[C@H](C)N2C(=O)[C@H]3CCCC[C@@H]3C2=O)ccc1C |
| InChI | InChI=1S/C22H31N3O5S/c1-5-24(6-2)31(29,30)19-13-16(12-11-14(19)3)23-20(26)15(4)25-21(27)17-9-7-8-10-18(17)22(25)28/h11-13,15,17-18H,5-10H2,1-4H3,(H,23,26)/t15-,17-,18-/m0/s1 |
| InChIKey | QRKHBFAMMHEZTB-SZMVWBNQSA-N |
| XLogP | 2.53 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|