C24H34N4O3S — CID 40809914
(2R)-N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-phenylpiperazin-1-yl)propanamide (PubChem CID 40809914) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is (2R)-N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-phenylpiperazin-1-yl)propanamide.
| Compound Name | (2R)-N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-phenylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 40809914 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | (2R)-N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-(4-phenylpiperazin-1-yl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)[C@@H](C)N2CCN(c3ccccc3)CC2)ccc1C |
| InChI | InChI=1S/C24H34N4O3S/c1-5-28(6-2)32(30,31)23-18-21(13-12-19(23)3)25-24(29)20(4)26-14-16-27(17-15-26)22-10-8-7-9-11-22/h7-13,18,20H,5-6,14-17H2,1-4H3,(H,25,29)/t20-/m1/s1 |
| InChIKey | VKDOEXMPQHQKPU-HXUWFJFHSA-N |
| XLogP | 3.17 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |