C23H37N5O4S — CID 30958984
(2S)-N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]propanamide (PubChem CID 30958984) has the molecular formula C23H37N5O4S and a molecular weight of 479.65 g/mol. Its IUPAC name is (2S)-N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30958984 |
| Molecular Formula | C23H37N5O4S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | (2S)-N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]propanamide |
| SMILES | C=CCNC(=O)CN1CCN([C@@H](C)C(=O)Nc2ccc(C)c(S(=O)(=O)N(CC)CC)c2)CC1 |
| InChI | InChI=1S/C23H37N5O4S/c1-6-11-24-22(29)17-26-12-14-27(15-13-26)19(5)23(30)25-20-10-9-18(4)21(16-20)33(31,32)28(7-2)8-3/h6,9-10,16,19H,1,7-8,11-15,17H2,2-5H3,(H,24,29)(H,25,30)/t19-/m0/s1 |
| InChIKey | VCJBVLFWUBLTKA-IBGZPJMESA-N |
| XLogP | 1.27 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|