C21H33N5O4S — CID 43036041
N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]propanamide (PubChem CID 43036041) has the molecular formula C21H33N5O4S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]propanamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 43036041 |
| Molecular Formula | C21H33N5O4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methylphenyl]-2-[4-[2-oxo-2-(prop-2-enylamino)ethyl]piperazin-1-yl]propanamide |
| SMILES | C=CCNC(=O)CN1CCN(C(C)C(=O)Nc2cc(S(=O)(=O)N(C)C)ccc2C)CC1 |
| InChI | InChI=1S/C21H33N5O4S/c1-6-9-22-20(27)15-25-10-12-26(13-11-25)17(3)21(28)23-19-14-18(8-7-16(19)2)31(29,30)24(4)5/h6-8,14,17H,1,9-13,15H2,2-5H3,(H,22,27)(H,23,28) |
| InChIKey | JSBMWJBEQJJLJV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|